About 4-propan-2-yl-1-propan-2-ylbenzene-6-ide;tris(yttrium)
4-propan-2-yl-1-propan-2-ylbenzene-6-ide;tris(yttrium) (PubChem CID 59323590) has the molecular formula C12H16Y3-2
and a molecular weight of 426.98 g/mol. Its IUPAC name is 4-propan-2-yl-1-propan-2-ylbenzene-6-ide;tris(yttrium).
Molecular Properties
| Compound Name | 4-propan-2-yl-1-propan-2-ylbenzene-6-ide;tris(yttrium) |
| PubChem CID | 59323590 |
| Molecular Formula | C12H16Y3-2 |
| Molecular Weight | 426.98 g/mol |
| Exact Mass | 426.84 |
| IUPAC Name | 4-propan-2-yl-1-propan-2-ylbenzene-6-ide;tris(yttrium) |
| SMILES | [CH2-]C(C)c1[c-]cc(C(C)C)cc1.[Y].[Y].[Y] |
| InChI | InChI=1S/C12H16.3Y/c1-9(2)11-5-7-12(8-6-11)10(3)4;;;/h5,7-10H,1H2,2-4H3;;;/q-2;;; |
| InChIKey | MFZNUZYHHHPSLS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.98 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-propan-2-yl-1-propan-2-ylbenzene-6-ide;tris(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-1-propan-2-ylbenzene-6-ide;tris(yttrium)?
The IUPAC name of 4-propan-2-yl-1-propan-2-ylbenzene-6-ide;tris(yttrium) (CID 59323590) is 4-propan-2-yl-1-propan-2-ylbenzene-6-ide;tris(yttrium).
What is the SMILES notation for 4-propan-2-yl-1-propan-2-ylbenzene-6-ide;tris(yttrium)?
The canonical SMILES for 4-propan-2-yl-1-propan-2-ylbenzene-6-ide;tris(yttrium) is [CH2-]C(C)c1[c-]cc(C(C)C)cc1.[Y].[Y].[Y].
What is the InChIKey of 4-propan-2-yl-1-propan-2-ylbenzene-6-ide;tris(yttrium)?
The InChIKey is MFZNUZYHHHPSLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.3Y/c1-9(2)11-5-7-12(8-6-11)10(3)4;;;/h5,7-10H,1H2,2-4H3;;;/q-2;;;.
What are the key properties of 4-propan-2-yl-1-propan-2-ylbenzene-6-ide;tris(yttrium)?
4-propan-2-yl-1-propan-2-ylbenzene-6-ide;tris(yttrium) has a molecular weight of 426.98 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-1-propan-2-ylbenzene-6-ide;tris(yttrium) is sourced from PubChem (CID 59323590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).