C30H41N3O9 — CID 59326263
[(2R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-[2-methylpropyl-(4-nitrophenoxy)amino]-4-phenylbutan-2-yl] [(3S)-oxolan-3-yl] carbonate (PubChem CID 59326263) has the molecular formula C30H41N3O9 and a molecular weight of 587.67 g/mol. Its IUPAC name is [(2R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-[2-methylpropyl-(4-nitrophenoxy)amino]-4-phenylbutan-2-yl] [(3S)-oxolan-3-yl] carbonate.
| Compound Name | [(2R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-[2-methylpropyl-(4-nitrophenoxy)amino]-4-phenylbutan-2-yl] [(3S)-oxolan-3-yl] carbonate |
|---|---|
| PubChem CID | 59326263 |
| Molecular Formula | C30H41N3O9 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.28 |
| IUPAC Name | [(2R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-[2-methylpropyl-(4-nitrophenoxy)amino]-4-phenylbutan-2-yl] [(3S)-oxolan-3-yl] carbonate |
| SMILES | CC(C)CN(C[C@@H](OC(=O)O[C@H]1CCOC1)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H41N3O9/c1-21(2)18-32(42-24-13-11-23(12-14-24)33(36)37)19-27(40-29(35)39-25-15-16-38-20-25)26(17-22-9-7-6-8-10-22)31-28(34)41-30(3,4)5/h6-14,21,25-27H,15-20H2,1-5H3,(H,31,34)/t25-,26-,27+/m0/s1 |
| InChIKey | FDFAHCTXPABIQE-GMQQYTKMSA-N |
| XLogP | 5.29 |
| TPSA | 138.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|