C34H48N4O12P2 — CID 90822348
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl phosphanyliminophosphanyl carbonate;tert-butyl N-[3-hydroxy-4-[(4-nitrophenyl)methyl-(oxan-4-yloxy)amino]-1-phenylbutan-2-yl]carbamate (PubChem CID 90822348) has the molecular formula C34H48N4O12P2 and a molecular weight of 766.72 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl phosphanyliminophosphanyl carbonate;tert-butyl N-[3-hydroxy-4-[(4-nitrophenyl)methyl-(oxan-4-yloxy)amino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl phosphanyliminophosphanyl carbonate;tert-butyl N-[3-hydroxy-4-[(4-nitrophenyl)methyl-(oxan-4-yloxy)amino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 90822348 |
| Molecular Formula | C34H48N4O12P2 |
| Molecular Weight | 766.72 g/mol |
| Exact Mass | 766.27 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl phosphanyliminophosphanyl carbonate;tert-butyl N-[3-hydroxy-4-[(4-nitrophenyl)methyl-(oxan-4-yloxy)amino]-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(O)CN(Cc1ccc([N+](=O)[O-])cc1)OC1CCOCC1.O=C(O/P=N/P)OC1COC2OCCC12 |
| InChI | InChI=1S/C27H37N3O7.C7H11NO5P2/c1-27(2,3)36-26(32)28-24(17-20-7-5-4-6-8-20)25(31)19-29(37-23-13-15-35-16-14-23)18-21-9-11-22(12-10-21)30(33)34;9-7(13-15-8-14)12-5-3-11-6-4(5)1-2-10-6/h4-12,23-25,31H,13-19H2,1-3H3,(H,28,32);4-6H,1-3,14H2 |
| InChIKey | FQQUTQVVXOHFRC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 189.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.72 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|