C27H30F3NO — CID 59336949
2-(6-methyl-2-phenyl-2-adamantyl)-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 59336949) has the molecular formula C27H30F3NO and a molecular weight of 441.54 g/mol. Its IUPAC name is 2-(6-methyl-2-phenyl-2-adamantyl)-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(6-methyl-2-phenyl-2-adamantyl)-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 59336949 |
| Molecular Formula | C27H30F3NO |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 2-(6-methyl-2-phenyl-2-adamantyl)-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | CC1C2CC3CC1CC(C2)C3(CC(=O)NCc1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H30F3NO/c1-17-19-11-23-13-20(17)14-24(12-19)26(23,21-5-3-2-4-6-21)15-25(32)31-16-18-7-9-22(10-8-18)27(28,29)30/h2-10,17,19-20,23-24H,11-16H2,1H3,(H,31,32) |
| InChIKey | QXXMEGVPBCLRJC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |