C20H38N2O3 — CID 59346295
(E,4S,5R,6R)-5-hydroxy-6-methyl-4-[methyl-[(3S)-5-methyl-3-(methylamino)-2-oxohexyl]amino]dec-8-en-3-one (PubChem CID 59346295) has the molecular formula C20H38N2O3 and a molecular weight of 354.54 g/mol. Its IUPAC name is (E,4S,5R,6R)-5-hydroxy-6-methyl-4-[methyl-[(3S)-5-methyl-3-(methylamino)-2-oxohexyl]amino]dec-8-en-3-one.
| Compound Name | (E,4S,5R,6R)-5-hydroxy-6-methyl-4-[methyl-[(3S)-5-methyl-3-(methylamino)-2-oxohexyl]amino]dec-8-en-3-one |
|---|---|
| PubChem CID | 59346295 |
| Molecular Formula | C20H38N2O3 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | (E,4S,5R,6R)-5-hydroxy-6-methyl-4-[methyl-[(3S)-5-methyl-3-(methylamino)-2-oxohexyl]amino]dec-8-en-3-one |
| SMILES | C/C=C/C[C@@H](C)[C@@H](O)[C@@H](C(=O)CC)N(C)CC(=O)[C@H](CC(C)C)NC |
| InChI | InChI=1S/C20H38N2O3/c1-8-10-11-15(5)20(25)19(17(23)9-2)22(7)13-18(24)16(21-6)12-14(3)4/h8,10,14-16,19-21,25H,9,11-13H2,1-7H3/b10-8+/t15-,16+,19-,20-/m1/s1 |
| InChIKey | RJPLJIHXHGJYIB-MXRJINKSSA-N |
| XLogP | 2.43 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|