About 10b,10c-dihydropyren-1-ol
10b,10c-dihydropyren-1-ol (PubChem CID 59366440) has the molecular formula C16H12O
and a molecular weight of 220.27 g/mol. Its IUPAC name is 10b,10c-dihydropyren-1-ol.
Molecular Properties
| Compound Name | 10b,10c-dihydropyren-1-ol |
| PubChem CID | 59366440 |
| Molecular Formula | C16H12O |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 10b,10c-dihydropyren-1-ol |
| SMILES | OC1=C2C=CC3=CC=CC4=CC=C(C=C1)C2C34 |
| InChI | InChI=1S/C16H12O/c17-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9,15-17H |
| InChIKey | JFDTWDBULAJJDH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 10b,10c-dihydropyren-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10b,10c-dihydropyren-1-ol?
The IUPAC name of 10b,10c-dihydropyren-1-ol (CID 59366440) is 10b,10c-dihydropyren-1-ol.
What is the SMILES notation for 10b,10c-dihydropyren-1-ol?
The canonical SMILES for 10b,10c-dihydropyren-1-ol is OC1=C2C=CC3=CC=CC4=CC=C(C=C1)C2C34.
What is the InChIKey of 10b,10c-dihydropyren-1-ol?
The InChIKey is JFDTWDBULAJJDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O/c17-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9,15-17H.
What are the key properties of 10b,10c-dihydropyren-1-ol?
10b,10c-dihydropyren-1-ol has a molecular weight of 220.27 g/mol, XLogP of 3.53, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10b,10c-dihydropyren-1-ol is sourced from PubChem (CID 59366440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).