C34H46O6 — CID 59386596
[(8'R,9'S,10'R,13'S,14'S,17'R)-10',13'-dimethyl-17'-(2-methyl-1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl] 4-ethylbenzoate (PubChem CID 59386596) has the molecular formula C34H46O6 and a molecular weight of 550.74 g/mol. Its IUPAC name is [(8'R,9'S,10'R,13'S,14'S,17'R)-10',13'-dimethyl-17'-(2-methyl-1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl] 4-ethylbenzoate.
| Compound Name | [(8'R,9'S,10'R,13'S,14'S,17'R)-10',13'-dimethyl-17'-(2-methyl-1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 59386596 |
| Molecular Formula | C34H46O6 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | [(8'R,9'S,10'R,13'S,14'S,17'R)-10',13'-dimethyl-17'-(2-methyl-1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)O[C@]2(C3(C)OCCO3)CC[C@H]3[C@@H]4CC=C5CC6(CC[C@]5(C)[C@H]4CC[C@@]32C)OCCO6)cc1 |
| InChI | InChI=1S/C34H46O6/c1-5-23-6-8-24(9-7-23)29(35)40-34(32(4)36-18-19-37-32)15-13-28-26-11-10-25-22-33(38-20-21-39-33)17-16-30(25,2)27(26)12-14-31(28,34)3/h6-10,26-28H,5,11-22H2,1-4H3/t26-,27+,28+,30+,31+,34-/m1/s1 |
| InChIKey | KCTUZFZIUQIMLE-VCSRRQNYSA-N |
| XLogP | 6.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|