C19H26O13 — CID 59391982
4,5-dioxo-6-[2-[2-[2-(2-propanoyloxypropanoyloxy)acetyl]oxyethoxy]acetyl]oxyheptanoic acid (PubChem CID 59391982) has the molecular formula C19H26O13 and a molecular weight of 462.40 g/mol. Its IUPAC name is 4,5-dioxo-6-[2-[2-[2-(2-propanoyloxypropanoyloxy)acetyl]oxyethoxy]acetyl]oxyheptanoic acid.
| Compound Name | 4,5-dioxo-6-[2-[2-[2-(2-propanoyloxypropanoyloxy)acetyl]oxyethoxy]acetyl]oxyheptanoic acid |
|---|---|
| PubChem CID | 59391982 |
| Molecular Formula | C19H26O13 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 4,5-dioxo-6-[2-[2-[2-(2-propanoyloxypropanoyloxy)acetyl]oxyethoxy]acetyl]oxyheptanoic acid |
| SMILES | CCC(=O)OC(C)C(=O)OCC(=O)OCCOCC(=O)OC(C)C(=O)C(=O)CCC(=O)O |
| InChI | InChI=1S/C19H26O13/c1-4-15(23)32-12(3)19(27)30-10-16(24)29-8-7-28-9-17(25)31-11(2)18(26)13(20)5-6-14(21)22/h11-12H,4-10H2,1-3H3,(H,21,22) |
| InChIKey | CZTDNKVQOXUAMK-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 185.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|