C19H12N2O3S — CID 59424420
7-(4-nitrophenoxy)-2-phenylthieno[3,2-b]pyridine (PubChem CID 59424420) has the molecular formula C19H12N2O3S and a molecular weight of 348.38 g/mol. Its IUPAC name is 7-(4-nitrophenoxy)-2-phenylthieno[3,2-b]pyridine.
| Compound Name | 7-(4-nitrophenoxy)-2-phenylthieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 59424420 |
| Molecular Formula | C19H12N2O3S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 7-(4-nitrophenoxy)-2-phenylthieno[3,2-b]pyridine |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccnc3cc(-c4ccccc4)sc23)cc1 |
| InChI | InChI=1S/C19H12N2O3S/c22-21(23)14-6-8-15(9-7-14)24-17-10-11-20-16-12-18(25-19(16)17)13-4-2-1-3-5-13/h1-12H |
| InChIKey | IWFFZJFPIHXRLP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|