C21H20N2O2S — CID 143171722
4-[7-(4-aminophenoxy)thieno[3,2-b]pyridin-2-yl]phenol;ethane (PubChem CID 143171722) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is 4-[7-(4-aminophenoxy)thieno[3,2-b]pyridin-2-yl]phenol;ethane.
| Compound Name | 4-[7-(4-aminophenoxy)thieno[3,2-b]pyridin-2-yl]phenol;ethane |
|---|---|
| PubChem CID | 143171722 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 4-[7-(4-aminophenoxy)thieno[3,2-b]pyridin-2-yl]phenol;ethane |
| SMILES | CC.Nc1ccc(Oc2ccnc3cc(-c4ccc(O)cc4)sc23)cc1 |
| InChI | InChI=1S/C19H14N2O2S.C2H6/c20-13-3-7-15(8-4-13)23-17-9-10-21-16-11-18(24-19(16)17)12-1-5-14(22)6-2-12;1-2/h1-11,22H,20H2;1-2H3 |
| InChIKey | HPUUOQBATFDCLD-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|