C12H14NY- — CID 59449235
2-tert-butyl-1,3-dihydroindol-3-ide;yttrium (PubChem CID 59449235) has the molecular formula C12H14NY- and a molecular weight of 261.16 g/mol. Its IUPAC name is 2-tert-butyl-1,3-dihydroindol-3-ide;yttrium.
| Compound Name | 2-tert-butyl-1,3-dihydroindol-3-ide;yttrium |
|---|---|
| PubChem CID | 59449235 |
| Molecular Formula | C12H14NY- |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 2-tert-butyl-1,3-dihydroindol-3-ide;yttrium |
| SMILES | CC(C)(C)c1[c-]c2ccccc2[nH]1.[Y] |
| InChI | InChI=1S/C12H14N.Y/c1-12(2,3)11-8-9-6-4-5-7-10(9)13-11;/h4-7,13H,1-3H3;/q-1; |
| InChIKey | JZKYBXRCRZRKMQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|