C13H10F2O2Te — CID 59456309
5-(4-ethoxy-2,3-difluorophenyl)tellurophene-2-carbaldehyde (PubChem CID 59456309) has the molecular formula C13H10F2O2Te and a molecular weight of 363.82 g/mol. Its IUPAC name is 5-(4-ethoxy-2,3-difluorophenyl)tellurophene-2-carbaldehyde.
| Compound Name | 5-(4-ethoxy-2,3-difluorophenyl)tellurophene-2-carbaldehyde |
|---|---|
| PubChem CID | 59456309 |
| Molecular Formula | C13H10F2O2Te |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | 5-(4-ethoxy-2,3-difluorophenyl)tellurophene-2-carbaldehyde |
| SMILES | CCOc1ccc(-c2ccc(C=O)[te]2)c(F)c1F |
| InChI | InChI=1S/C13H10F2O2Te/c1-2-17-10-5-4-9(12(14)13(10)15)11-6-3-8(7-16)18-11/h3-7H,2H2,1H3 |
| InChIKey | PPCAGQQLZQMSTG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|