About CID 59480071
CID 59480071 (PubChem CID 59480071) has the molecular formula C17H22N3O2Y-
and a molecular weight of 389.29 g/mol.
Molecular Properties
| Compound Name | CID 59480071 |
| PubChem CID | 59480071 |
| Molecular Formula | C17H22N3O2Y- |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | — |
| SMILES | C=c1c(C)c(C(=O)OC2C(C)CC(C)CC2C)c2n[c-]nn12.[Y] |
| InChI | InChI=1S/C17H22N3O2.Y/c1-9-6-10(2)15(11(3)7-9)22-17(21)14-12(4)13(5)20-16(14)18-8-19-20;/h9-11,15H,5-7H2,1-4H3;/q-1; |
| InChIKey | INXZRYWHAARYPQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59480071 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59480071?
The IUPAC name of CID 59480071 (CID 59480071) is not available.
What is the SMILES notation for CID 59480071?
The canonical SMILES for CID 59480071 is C=c1c(C)c(C(=O)OC2C(C)CC(C)CC2C)c2n[c-]nn12.[Y].
What is the InChIKey of CID 59480071?
The InChIKey is INXZRYWHAARYPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N3O2.Y/c1-9-6-10(2)15(11(3)7-9)22-17(21)14-12(4)13(5)20-16(14)18-8-19-20;/h9-11,15H,5-7H2,1-4H3;/q-1;.
What are the key properties of CID 59480071?
CID 59480071 has a molecular weight of 389.29 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59480071 is sourced from PubChem (CID 59480071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).