C17H22N3O2Y- — CID 59480071
CID 59480071 (PubChem CID 59480071) has the molecular formula C17H22N3O2Y- and a molecular weight of 389.29 g/mol.
| Compound Name | CID 59480071 |
|---|---|
| PubChem CID | 59480071 |
| Molecular Formula | C17H22N3O2Y- |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | — |
| SMILES | C=c1c(C)c(C(=O)OC2C(C)CC(C)CC2C)c2n[c-]nn12.[Y] |
| InChI | InChI=1S/C17H22N3O2.Y/c1-9-6-10(2)15(11(3)7-9)22-17(21)14-12(4)13(5)20-16(14)18-8-19-20;/h9-11,15H,5-7H2,1-4H3;/q-1; |
| InChIKey | INXZRYWHAARYPQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|