C37H54N2O7 — CID 59511000
benzyl 4-cyano-7-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylamino]-2,6,6-trimethyl-7-oxo-2-(2-phenylbutyl)heptanoate (PubChem CID 59511000) has the molecular formula C37H54N2O7 and a molecular weight of 638.85 g/mol. Its IUPAC name is benzyl 4-cyano-7-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylamino]-2,6,6-trimethyl-7-oxo-2-(2-phenylbutyl)heptanoate.
| Compound Name | benzyl 4-cyano-7-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylamino]-2,6,6-trimethyl-7-oxo-2-(2-phenylbutyl)heptanoate |
|---|---|
| PubChem CID | 59511000 |
| Molecular Formula | C37H54N2O7 |
| Molecular Weight | 638.85 g/mol |
| Exact Mass | 638.39 |
| IUPAC Name | benzyl 4-cyano-7-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylamino]-2,6,6-trimethyl-7-oxo-2-(2-phenylbutyl)heptanoate |
| SMILES | CCC(CC(C)(CC(C#N)CC(C)(C)C(=O)NCCOCCOCCOCCOC)C(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H54N2O7/c1-6-32(33-15-11-8-12-16-33)27-37(4,35(41)46-29-30-13-9-7-10-14-30)26-31(28-38)25-36(2,3)34(40)39-17-18-43-21-22-45-24-23-44-20-19-42-5/h7-16,31-32H,6,17-27,29H2,1-5H3,(H,39,40) |
| InChIKey | OMBRMRWIWOESIR-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 116.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.85 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|