C26H28N2O8S3 — CID 59539890
(2,5-dioxopyrrolidin-1-yl) 3-[9-[methylsulfanyl-[3-(trioxidanylsulfanyl)propylsulfanyl]methylidene]acridin-10-yl]propyl carbonate (PubChem CID 59539890) has the molecular formula C26H28N2O8S3 and a molecular weight of 592.72 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[9-[methylsulfanyl-[3-(trioxidanylsulfanyl)propylsulfanyl]methylidene]acridin-10-yl]propyl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[9-[methylsulfanyl-[3-(trioxidanylsulfanyl)propylsulfanyl]methylidene]acridin-10-yl]propyl carbonate |
|---|---|
| PubChem CID | 59539890 |
| Molecular Formula | C26H28N2O8S3 |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[9-[methylsulfanyl-[3-(trioxidanylsulfanyl)propylsulfanyl]methylidene]acridin-10-yl]propyl carbonate |
| SMILES | CSC(SCCCSOOO)=C1c2ccccc2N(CCCOC(=O)ON2C(=O)CCC2=O)c2ccccc21 |
| InChI | InChI=1S/C26H28N2O8S3/c1-37-25(38-16-7-17-39-36-35-32)24-18-8-2-4-10-20(18)27(21-11-5-3-9-19(21)24)14-6-15-33-26(31)34-28-22(29)12-13-23(28)30/h2-5,8-11,32H,6-7,12-17H2,1H3 |
| InChIKey | NFGOZEQBSGLRJM-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 114.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|