C30H31N9O3S — CID 59567549
(6S,9aS)-6-[(2-aminopyrimidin-5-yl)methyl]-8-(1,3-benzothiazol-4-ylmethyl)-N-benzyl-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 59567549) has the molecular formula C30H31N9O3S and a molecular weight of 597.71 g/mol. Its IUPAC name is (6S,9aS)-6-[(2-aminopyrimidin-5-yl)methyl]-8-(1,3-benzothiazol-4-ylmethyl)-N-benzyl-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-6-[(2-aminopyrimidin-5-yl)methyl]-8-(1,3-benzothiazol-4-ylmethyl)-N-benzyl-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 59567549 |
| Molecular Formula | C30H31N9O3S |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.23 |
| IUPAC Name | (6S,9aS)-6-[(2-aminopyrimidin-5-yl)methyl]-8-(1,3-benzothiazol-4-ylmethyl)-N-benzyl-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=CCN1CC(=O)N2[C@@H](Cc3cnc(N)nc3)C(=O)N(Cc3cccc4scnc34)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C30H31N9O3S/c1-2-11-37-18-26(40)38-23(12-21-14-32-29(31)33-15-21)28(41)36(16-22-9-6-10-24-27(22)35-19-43-24)17-25(38)39(37)30(42)34-13-20-7-4-3-5-8-20/h2-10,14-15,19,23,25H,1,11-13,16-18H2,(H,34,42)(H2,31,32,33)/t23-,25-/m0/s1 |
| InChIKey | RKRUVZHZHDTJMH-ZCYQVOJMSA-N |
| XLogP | 2.41 |
| TPSA | 140.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|