C29H36N8O5S2 — CID 59567828
(6S,9aS)-8-(1,3-benzothiazol-4-ylmethyl)-N-benzyl-4,7-dioxo-2-prop-2-enyl-6-[4-(sulfamoylamino)butyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 59567828) has the molecular formula C29H36N8O5S2 and a molecular weight of 640.79 g/mol. Its IUPAC name is (6S,9aS)-8-(1,3-benzothiazol-4-ylmethyl)-N-benzyl-4,7-dioxo-2-prop-2-enyl-6-[4-(sulfamoylamino)butyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-8-(1,3-benzothiazol-4-ylmethyl)-N-benzyl-4,7-dioxo-2-prop-2-enyl-6-[4-(sulfamoylamino)butyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 59567828 |
| Molecular Formula | C29H36N8O5S2 |
| Molecular Weight | 640.79 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | (6S,9aS)-8-(1,3-benzothiazol-4-ylmethyl)-N-benzyl-4,7-dioxo-2-prop-2-enyl-6-[4-(sulfamoylamino)butyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=CCN1CC(=O)N2[C@@H](CCCCNS(N)(=O)=O)C(=O)N(Cc3cccc4scnc34)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C29H36N8O5S2/c1-2-15-35-19-26(38)36-23(12-6-7-14-33-44(30,41)42)28(39)34(17-22-11-8-13-24-27(22)32-20-43-24)18-25(36)37(35)29(40)31-16-21-9-4-3-5-10-21/h2-5,8-11,13,20,23,25,33H,1,6-7,12,14-19H2,(H,31,40)(H2,30,41,42)/t23-,25-/m0/s1 |
| InChIKey | LRJOMJMKVISSFP-ZCYQVOJMSA-N |
| XLogP | 1.75 |
| TPSA | 161.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.79 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|