C21H29NO4 — CID 59578205
2-[(6E)-14,16-dimethyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(16),6,12,14-tetraen-10-yl]-N-methoxy-N-methylacetamide (PubChem CID 59578205) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-[(6E)-14,16-dimethyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(16),6,12,14-tetraen-10-yl]-N-methoxy-N-methylacetamide.
| Compound Name | 2-[(6E)-14,16-dimethyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(16),6,12,14-tetraen-10-yl]-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 59578205 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 2-[(6E)-14,16-dimethyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(16),6,12,14-tetraen-10-yl]-N-methoxy-N-methylacetamide |
| SMILES | CON(C)C(=O)CC1CC/C=C/CCOC(=O)c2c(C)cc(C)cc2C1 |
| InChI | InChI=1S/C21H29NO4/c1-15-11-16(2)20-18(12-15)13-17(14-19(23)22(3)25-4)9-7-5-6-8-10-26-21(20)24/h5-6,11-12,17H,7-10,13-14H2,1-4H3/b6-5+ |
| InChIKey | CXTBEFGHEWZOEY-AATRIKPKSA-N |
| XLogP | 3.77 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|