C23H38Si — CID 59653718
(6-ethenyl-6,8,9-trimethyldec-9-en-2-yl)-dimethyl-phenylsilane (PubChem CID 59653718) has the molecular formula C23H38Si and a molecular weight of 342.64 g/mol. Its IUPAC name is (6-ethenyl-6,8,9-trimethyldec-9-en-2-yl)-dimethyl-phenylsilane.
| Compound Name | (6-ethenyl-6,8,9-trimethyldec-9-en-2-yl)-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 59653718 |
| Molecular Formula | C23H38Si |
| Molecular Weight | 342.64 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | (6-ethenyl-6,8,9-trimethyldec-9-en-2-yl)-dimethyl-phenylsilane |
| SMILES | C=CC(C)(CCCC(C)[Si](C)(C)c1ccccc1)CC(C)C(=C)C |
| InChI | InChI=1S/C23H38Si/c1-9-23(6,18-20(4)19(2)3)17-13-14-21(5)24(7,8)22-15-11-10-12-16-22/h9-12,15-16,20-21H,1-2,13-14,17-18H2,3-8H3 |
| InChIKey | CZWVTNDRTGXEQH-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.64 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|