C14H30N4O3 — CID 59712783
methyl (2R)-6-[[amino(methoxy)methylidene]amino]-2-[4-(methylamino)butylamino]hexanoate (PubChem CID 59712783) has the molecular formula C14H30N4O3 and a molecular weight of 302.42 g/mol. Its IUPAC name is methyl (2R)-6-[[amino(methoxy)methylidene]amino]-2-[4-(methylamino)butylamino]hexanoate.
| Compound Name | methyl (2R)-6-[[amino(methoxy)methylidene]amino]-2-[4-(methylamino)butylamino]hexanoate |
|---|---|
| PubChem CID | 59712783 |
| Molecular Formula | C14H30N4O3 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | methyl (2R)-6-[[amino(methoxy)methylidene]amino]-2-[4-(methylamino)butylamino]hexanoate |
| SMILES | CNCCCCN[C@H](CCCC/N=C(/N)OC)C(=O)OC |
| InChI | InChI=1S/C14H30N4O3/c1-16-9-6-7-10-17-12(13(19)20-2)8-4-5-11-18-14(15)21-3/h12,16-17H,4-11H2,1-3H3,(H2,15,18)/t12-/m1/s1 |
| InChIKey | XILYDVDXTOFSHP-GFCCVEGCSA-N |
| XLogP | 0.25 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|