C15H27NO6 — CID 59713222
[1-(heptylcarbamoyloxy)-2,3-dihydroxypropyl] 2-methylprop-2-enoate (PubChem CID 59713222) has the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. Its IUPAC name is [1-(heptylcarbamoyloxy)-2,3-dihydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [1-(heptylcarbamoyloxy)-2,3-dihydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59713222 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | [1-(heptylcarbamoyloxy)-2,3-dihydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(OC(=O)NCCCCCCC)C(O)CO |
| InChI | InChI=1S/C15H27NO6/c1-4-5-6-7-8-9-16-15(20)22-14(12(18)10-17)21-13(19)11(2)3/h12,14,17-18H,2,4-10H2,1,3H3,(H,16,20) |
| InChIKey | FUQLBLBITILXNG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|