C25H24N2O4 — CID 59728726
3-[4-[(E)-2-cyano-2-(4-ethoxyphenyl)-1-isocyanoethenyl]phenoxy]propyl 2-methylprop-2-enoate (PubChem CID 59728726) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 3-[4-[(E)-2-cyano-2-(4-ethoxyphenyl)-1-isocyanoethenyl]phenoxy]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[4-[(E)-2-cyano-2-(4-ethoxyphenyl)-1-isocyanoethenyl]phenoxy]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59728726 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 3-[4-[(E)-2-cyano-2-(4-ethoxyphenyl)-1-isocyanoethenyl]phenoxy]propyl 2-methylprop-2-enoate |
| SMILES | [C-]#[N+]/C(=C(/C#N)c1ccc(OCC)cc1)c1ccc(OCCCOC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C25H24N2O4/c1-5-29-21-11-7-19(8-12-21)23(17-26)24(27-4)20-9-13-22(14-10-20)30-15-6-16-31-25(28)18(2)3/h7-14H,2,5-6,15-16H2,1,3H3/b24-23- |
| InChIKey | FAJYACJEWYAFLE-VHXPQNKSSA-N |
| XLogP | 5.28 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|