C19H23NO3 — CID 59736864
3,4,5-trimethoxy-N-[[4-[(E)-prop-1-enyl]phenyl]methyl]aniline (PubChem CID 59736864) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[[4-[(E)-prop-1-enyl]phenyl]methyl]aniline.
| Compound Name | 3,4,5-trimethoxy-N-[[4-[(E)-prop-1-enyl]phenyl]methyl]aniline |
|---|---|
| PubChem CID | 59736864 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 3,4,5-trimethoxy-N-[[4-[(E)-prop-1-enyl]phenyl]methyl]aniline |
| SMILES | C/C=C/c1ccc(CNc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H23NO3/c1-5-6-14-7-9-15(10-8-14)13-20-16-11-17(21-2)19(23-4)18(12-16)22-3/h5-12,20H,13H2,1-4H3/b6-5+ |
| InChIKey | PPOKCXQPDJKSTJ-AATRIKPKSA-N |
| XLogP | 4.36 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|