C20H27FIrNP — CID 59782104
(2-fluoro-5-pyridin-2-ylbenzene-4-id-1-yl)-tripropylphosphanium;iridium (PubChem CID 59782104) has the molecular formula C20H27FIrNP and a molecular weight of 523.63 g/mol. Its IUPAC name is (2-fluoro-5-pyridin-2-ylbenzene-4-id-1-yl)-tripropylphosphanium;iridium.
| Compound Name | (2-fluoro-5-pyridin-2-ylbenzene-4-id-1-yl)-tripropylphosphanium;iridium |
|---|---|
| PubChem CID | 59782104 |
| Molecular Formula | C20H27FIrNP |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | (2-fluoro-5-pyridin-2-ylbenzene-4-id-1-yl)-tripropylphosphanium;iridium |
| SMILES | CCC[P+](CCC)(CCC)c1cc(-c2ccccn2)[c-]cc1F.[Ir] |
| InChI | InChI=1S/C20H27FNP.Ir/c1-4-13-23(14-5-2,15-6-3)20-16-17(10-11-18(20)21)19-9-7-8-12-22-19;/h7-9,11-12,16H,4-6,13-15H2,1-3H3; |
| InChIKey | TVUSLCUYLVCVTK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|