C24H34N2O10 — CID 59782543
2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl 3-[2-[[3-(2-methoxypropoxy)-3-oxopropanoyl]amino]ethylamino]-3-oxopropanoate (PubChem CID 59782543) has the molecular formula C24H34N2O10 and a molecular weight of 510.54 g/mol. Its IUPAC name is 2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl 3-[2-[[3-(2-methoxypropoxy)-3-oxopropanoyl]amino]ethylamino]-3-oxopropanoate.
| Compound Name | 2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl 3-[2-[[3-(2-methoxypropoxy)-3-oxopropanoyl]amino]ethylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 59782543 |
| Molecular Formula | C24H34N2O10 |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl 3-[2-[[3-(2-methoxypropoxy)-3-oxopropanoyl]amino]ethylamino]-3-oxopropanoate |
| SMILES | COC(C)COC(=O)CC(=O)NCCNC(=O)CC(=O)OCCOc1ccc(C(=O)C(C)(C)O)cc1 |
| InChI | InChI=1S/C24H34N2O10/c1-16(33-4)15-36-22(30)14-20(28)26-10-9-25-19(27)13-21(29)35-12-11-34-18-7-5-17(6-8-18)23(31)24(2,3)32/h5-8,16,32H,9-15H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | CGIVTIOPSOCJBL-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 166.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|