About 5-(oxomethoxy)hexane-2,4-dione;yttrium
5-(oxomethoxy)hexane-2,4-dione;yttrium (PubChem CID 59785998) has the molecular formula C7H9O4Y-
and a molecular weight of 246.05 g/mol. Its IUPAC name is 5-(oxomethoxy)hexane-2,4-dione;yttrium.
Molecular Properties
| Compound Name | 5-(oxomethoxy)hexane-2,4-dione;yttrium |
| PubChem CID | 59785998 |
| Molecular Formula | C7H9O4Y- |
| Molecular Weight | 246.05 g/mol |
| Exact Mass | 245.96 |
| IUPAC Name | 5-(oxomethoxy)hexane-2,4-dione;yttrium |
| SMILES | CC(=O)CC(=O)C(C)O[C-]=O.[Y] |
| InChI | InChI=1S/C7H9O4.Y/c1-5(9)3-7(10)6(2)11-4-8;/h6H,3H2,1-2H3;/q-1; |
| InChIKey | ZWBCYRJZMGIWOD-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.05 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-(oxomethoxy)hexane-2,4-dione;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxomethoxy)hexane-2,4-dione;yttrium?
The IUPAC name of 5-(oxomethoxy)hexane-2,4-dione;yttrium (CID 59785998) is 5-(oxomethoxy)hexane-2,4-dione;yttrium.
What is the SMILES notation for 5-(oxomethoxy)hexane-2,4-dione;yttrium?
The canonical SMILES for 5-(oxomethoxy)hexane-2,4-dione;yttrium is CC(=O)CC(=O)C(C)O[C-]=O.[Y].
What is the InChIKey of 5-(oxomethoxy)hexane-2,4-dione;yttrium?
The InChIKey is ZWBCYRJZMGIWOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9O4.Y/c1-5(9)3-7(10)6(2)11-4-8;/h6H,3H2,1-2H3;/q-1;.
What are the key properties of 5-(oxomethoxy)hexane-2,4-dione;yttrium?
5-(oxomethoxy)hexane-2,4-dione;yttrium has a molecular weight of 246.05 g/mol, XLogP of 0.00, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxomethoxy)hexane-2,4-dione;yttrium is sourced from PubChem (CID 59785998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).