C22H47N2O6Si+ — CID 59805194
trimethyl-[3-[[2,2,4-trimethyl-4-(3-trimethoxysilylpropoxycarbonyl)hexanoyl]amino]propyl]azanium (PubChem CID 59805194) has the molecular formula C22H47N2O6Si+ and a molecular weight of 463.71 g/mol. Its IUPAC name is trimethyl-[3-[[2,2,4-trimethyl-4-(3-trimethoxysilylpropoxycarbonyl)hexanoyl]amino]propyl]azanium.
| Compound Name | trimethyl-[3-[[2,2,4-trimethyl-4-(3-trimethoxysilylpropoxycarbonyl)hexanoyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 59805194 |
| Molecular Formula | C22H47N2O6Si+ |
| Molecular Weight | 463.71 g/mol |
| Exact Mass | 463.32 |
| IUPAC Name | trimethyl-[3-[[2,2,4-trimethyl-4-(3-trimethoxysilylpropoxycarbonyl)hexanoyl]amino]propyl]azanium |
| SMILES | CCC(C)(CC(C)(C)C(=O)NCCC[N+](C)(C)C)C(=O)OCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C22H46N2O6Si/c1-11-22(4,20(26)30-16-13-17-31(27-8,28-9)29-10)18-21(2,3)19(25)23-14-12-15-24(5,6)7/h11-18H2,1-10H3/p+1 |
| InChIKey | KBIYQUPNJVACHH-UHFFFAOYSA-O |
| XLogP | 2.84 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.71 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|