C27H21F3N4O3 — CID 59808195
N-[3-(2,1,3-benzoxadiazol-5-ylmethoxy)phenyl]-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide (PubChem CID 59808195) has the molecular formula C27H21F3N4O3 and a molecular weight of 506.48 g/mol. Its IUPAC name is N-[3-(2,1,3-benzoxadiazol-5-ylmethoxy)phenyl]-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | N-[3-(2,1,3-benzoxadiazol-5-ylmethoxy)phenyl]-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59808195 |
| Molecular Formula | C27H21F3N4O3 |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | N-[3-(2,1,3-benzoxadiazol-5-ylmethoxy)phenyl]-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(OCc3ccc4nonc4c3)c2)c(C)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C27H21F3N4O3/c1-16-12-21(17(2)34(16)25-9-4-3-8-22(25)27(28,29)30)26(35)31-19-6-5-7-20(14-19)36-15-18-10-11-23-24(13-18)33-37-32-23/h3-14H,15H2,1-2H3,(H,31,35) |
| InChIKey | IYJQIPYFWPJEQL-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|