C32H37N2O6P2+ — CID 59816296
2-[(2'E)-2'-[(E)-3-[3,3-dimethyl-1-(2-phosphonoethyl)benzo[g]indol-1-ium-2-yl]prop-2-enylidene]spiro[cyclobutane-1,3'-indole]-1'-yl]ethylphosphonic acid (PubChem CID 59816296) has the molecular formula C32H37N2O6P2+ and a molecular weight of 607.60 g/mol. Its IUPAC name is 2-[(2'E)-2'-[(E)-3-[3,3-dimethyl-1-(2-phosphonoethyl)benzo[g]indol-1-ium-2-yl]prop-2-enylidene]spiro[cyclobutane-1,3'-indole]-1'-yl]ethylphosphonic acid.
| Compound Name | 2-[(2'E)-2'-[(E)-3-[3,3-dimethyl-1-(2-phosphonoethyl)benzo[g]indol-1-ium-2-yl]prop-2-enylidene]spiro[cyclobutane-1,3'-indole]-1'-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 59816296 |
| Molecular Formula | C32H37N2O6P2+ |
| Molecular Weight | 607.60 g/mol |
| Exact Mass | 607.21 |
| IUPAC Name | 2-[(2'E)-2'-[(E)-3-[3,3-dimethyl-1-(2-phosphonoethyl)benzo[g]indol-1-ium-2-yl]prop-2-enylidene]spiro[cyclobutane-1,3'-indole]-1'-yl]ethylphosphonic acid |
| SMILES | CC1(C)C(/C=C/C=C2/N(CCP(=O)(O)O)c3ccccc3C23CCC3)=[N+](CCP(=O)(O)O)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C32H36N2O6P2/c1-31(2)26-16-15-23-9-3-4-10-24(23)30(26)34(20-22-42(38,39)40)28(31)13-7-14-29-32(17-8-18-32)25-11-5-6-12-27(25)33(29)19-21-41(35,36)37/h3-7,9-16H,8,17-22H2,1-2H3,(H3-,35,36,37,38,39,40)/p+1 |
| InChIKey | ISNOFJQIAAXMEX-UHFFFAOYSA-O |
| XLogP | 5.95 |
| TPSA | 121.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.60 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|