C16H8Cl4N2 — CID 59834794
2,4-dichloro-5,6-bis(4-chlorophenyl)pyrimidine (PubChem CID 59834794) has the molecular formula C16H8Cl4N2 and a molecular weight of 370.07 g/mol. Its IUPAC name is 2,4-dichloro-5,6-bis(4-chlorophenyl)pyrimidine.
| Compound Name | 2,4-dichloro-5,6-bis(4-chlorophenyl)pyrimidine |
|---|---|
| PubChem CID | 59834794 |
| Molecular Formula | C16H8Cl4N2 |
| Molecular Weight | 370.07 g/mol |
| Exact Mass | 367.94 |
| IUPAC Name | 2,4-dichloro-5,6-bis(4-chlorophenyl)pyrimidine |
| SMILES | Clc1ccc(-c2nc(Cl)nc(Cl)c2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H8Cl4N2/c17-11-5-1-9(2-6-11)13-14(21-16(20)22-15(13)19)10-3-7-12(18)8-4-10/h1-8H |
| InChIKey | QCBOSEQJXRUBEG-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.07 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |