C20H20N2O2Y-2 — CID 59873180
benzene;3-(2,4-dimethylbenzene-5-id-1-yl)-1,6-dimethylpyrimidine-2,4-dione;yttrium (PubChem CID 59873180) has the molecular formula C20H20N2O2Y-2 and a molecular weight of 409.30 g/mol. Its IUPAC name is benzene;3-(2,4-dimethylbenzene-5-id-1-yl)-1,6-dimethylpyrimidine-2,4-dione;yttrium.
| Compound Name | benzene;3-(2,4-dimethylbenzene-5-id-1-yl)-1,6-dimethylpyrimidine-2,4-dione;yttrium |
|---|---|
| PubChem CID | 59873180 |
| Molecular Formula | C20H20N2O2Y-2 |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | benzene;3-(2,4-dimethylbenzene-5-id-1-yl)-1,6-dimethylpyrimidine-2,4-dione;yttrium |
| SMILES | Cc1[c-]cc(-n2c(=O)cc(C)n(C)c2=O)c(C)c1.[Y].[c-]1ccccc1 |
| InChI | InChI=1S/C14H15N2O2.C6H5.Y/c1-9-5-6-12(10(2)7-9)16-13(17)8-11(3)15(4)14(16)18;1-2-4-6-5-3-1;/h6-8H,1-4H3;1-5H;/q2*-1; |
| InChIKey | NGGPZLVVPBAEII-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|