About bis(benzotriazol-1-ide);gold
bis(benzotriazol-1-ide);gold (PubChem CID 59873850) has the molecular formula C12H8AuN6-2
and a molecular weight of 433.21 g/mol. Its IUPAC name is bis(benzotriazol-1-ide);gold.
Molecular Properties
| Compound Name | bis(benzotriazol-1-ide);gold |
| PubChem CID | 59873850 |
| Molecular Formula | C12H8AuN6-2 |
| Molecular Weight | 433.21 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | bis(benzotriazol-1-ide);gold |
| SMILES | [Au].c1ccc2[n-]nnc2c1.c1ccc2[n-]nnc2c1 |
| InChI | InChI=1S/2C6H4N3.Au/c2*1-2-4-6-5(3-1)7-9-8-6;/h2*1-4H;/q2*-1; |
| InChIKey | RXZWCQJPDWRUMB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(benzotriazol-1-ide);gold with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(benzotriazol-1-ide);gold?
The IUPAC name of bis(benzotriazol-1-ide);gold (CID 59873850) is bis(benzotriazol-1-ide);gold.
What is the SMILES notation for bis(benzotriazol-1-ide);gold?
The canonical SMILES for bis(benzotriazol-1-ide);gold is [Au].c1ccc2[n-]nnc2c1.c1ccc2[n-]nnc2c1.
What is the InChIKey of bis(benzotriazol-1-ide);gold?
The InChIKey is RXZWCQJPDWRUMB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H4N3.Au/c2*1-2-4-6-5(3-1)7-9-8-6;/h2*1-4H;/q2*-1;.
What are the key properties of bis(benzotriazol-1-ide);gold?
bis(benzotriazol-1-ide);gold has a molecular weight of 433.21 g/mol, XLogP of 1.17, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(benzotriazol-1-ide);gold is sourced from PubChem (CID 59873850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).