About benzotriazol-1-ide;methanol;uranium
benzotriazol-1-ide;methanol;uranium (PubChem CID 161028808) has the molecular formula C7H8N3OU-
and a molecular weight of 388.19 g/mol. Its IUPAC name is benzotriazol-1-ide;methanol;uranium.
Molecular Properties
| Compound Name | benzotriazol-1-ide;methanol;uranium |
| PubChem CID | 161028808 |
| Molecular Formula | C7H8N3OU- |
| Molecular Weight | 388.19 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | benzotriazol-1-ide;methanol;uranium |
| SMILES | CO.[U].c1ccc2[n-]nnc2c1 |
| InChI | InChI=1S/C6H4N3.CH4O.U/c1-2-4-6-5(3-1)7-9-8-6;1-2;/h1-4H;2H,1H3;/q-1;; |
| InChIKey | IVPAXQUIWVSQCW-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 60.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.19 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzotriazol-1-ide;methanol;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzotriazol-1-ide;methanol;uranium?
The IUPAC name of benzotriazol-1-ide;methanol;uranium (CID 161028808) is benzotriazol-1-ide;methanol;uranium.
What is the SMILES notation for benzotriazol-1-ide;methanol;uranium?
The canonical SMILES for benzotriazol-1-ide;methanol;uranium is CO.[U].c1ccc2[n-]nnc2c1.
What is the InChIKey of benzotriazol-1-ide;methanol;uranium?
The InChIKey is IVPAXQUIWVSQCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N3.CH4O.U/c1-2-4-6-5(3-1)7-9-8-6;1-2;/h1-4H;2H,1H3;/q-1;;.
What are the key properties of benzotriazol-1-ide;methanol;uranium?
benzotriazol-1-ide;methanol;uranium has a molecular weight of 388.19 g/mol, XLogP of 0.20, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzotriazol-1-ide;methanol;uranium is sourced from PubChem (CID 161028808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).