About silver benzimidazol-1-ide
silver benzimidazol-1-ide (PubChem CID 24939896) has the molecular formula C7H5AgN2
and a molecular weight of 225.00 g/mol. Its IUPAC name is silver benzimidazol-1-ide.
Molecular Properties
| Compound Name | silver benzimidazol-1-ide |
| PubChem CID | 24939896 |
| Molecular Formula | C7H5AgN2 |
| Molecular Weight | 225.00 g/mol |
| Exact Mass | 223.95 |
| IUPAC Name | silver benzimidazol-1-ide |
| SMILES | [Ag+].c1ccc2[n-]cnc2c1 |
| InChI | InChI=1S/C7H5N2.Ag/c1-2-4-7-6(3-1)8-5-9-7;/h1-5H;/q-1;+1 |
| InChIKey | IWQFMSXYOSAMAZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 26.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.00 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze silver benzimidazol-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver benzimidazol-1-ide?
The IUPAC name of silver benzimidazol-1-ide (CID 24939896) is silver benzimidazol-1-ide.
What is the SMILES notation for silver benzimidazol-1-ide?
The canonical SMILES for silver benzimidazol-1-ide is [Ag+].c1ccc2[n-]cnc2c1.
What is the InChIKey of silver benzimidazol-1-ide?
The InChIKey is IWQFMSXYOSAMAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N2.Ag/c1-2-4-7-6(3-1)8-5-9-7;/h1-5H;/q-1;+1.
What are the key properties of silver benzimidazol-1-ide?
silver benzimidazol-1-ide has a molecular weight of 225.00 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for silver benzimidazol-1-ide is sourced from PubChem (CID 24939896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).