C6H12NRf- — CID 59894849
2,4-dimethylpyrrolidin-1-ide;rutherfordium (PubChem CID 59894849) has the molecular formula C6H12NRf- and a molecular weight of 365.17 g/mol. Its IUPAC name is 2,4-dimethylpyrrolidin-1-ide;rutherfordium.
| Compound Name | 2,4-dimethylpyrrolidin-1-ide;rutherfordium |
|---|---|
| PubChem CID | 59894849 |
| Molecular Formula | C6H12NRf- |
| Molecular Weight | 365.17 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 2,4-dimethylpyrrolidin-1-ide;rutherfordium |
| SMILES | CC1C[N-]C(C)C1.[Rf] |
| InChI | InChI=1S/C6H12N.Rf/c1-5-3-6(2)7-4-5;/h5-6H,3-4H2,1-2H3;/q-1; |
| InChIKey | MHSPRAFKXGLFCI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.17 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |