C12H15N — CID 59940834
6-propan-2-yl-4a,8a-dihydroquinoline (PubChem CID 59940834) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 6-propan-2-yl-4a,8a-dihydroquinoline.
| Compound Name | 6-propan-2-yl-4a,8a-dihydroquinoline |
|---|---|
| PubChem CID | 59940834 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 6-propan-2-yl-4a,8a-dihydroquinoline |
| SMILES | CC(C)C1=CC2C=CC=NC2C=C1 |
| InChI | InChI=1S/C12H15N/c1-9(2)10-5-6-12-11(8-10)4-3-7-13-12/h3-9,11-12H,1-2H3 |
| InChIKey | ZVCFUTCNLGJIEG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |