C17H20N4O5 — CID 59947653
N-[(10S)-10-formyl-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepin-2-yl]-4-methoxybenzamide (PubChem CID 59947653) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is N-[(10S)-10-formyl-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepin-2-yl]-4-methoxybenzamide.
| Compound Name | N-[(10S)-10-formyl-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepin-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 59947653 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-[(10S)-10-formyl-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepin-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NN2CCC(=O)N3CCC[C@@H](C=O)N3C2=O)cc1 |
| InChI | InChI=1S/C17H20N4O5/c1-26-14-6-4-12(5-7-14)16(24)18-19-10-8-15(23)20-9-2-3-13(11-22)21(20)17(19)25/h4-7,11,13H,2-3,8-10H2,1H3,(H,18,24)/t13-/m0/s1 |
| InChIKey | XILJLIUBSZCCEY-ZDUSSCGKSA-N |
| XLogP | 0.57 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|