C23H31N5O7 — CID 90979358
N-[(10S)-10-formyl-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepin-2-yl]-4-methoxybenzamide;(2S)-2-(methylamino)-4-oxopentanal (PubChem CID 90979358) has the molecular formula C23H31N5O7 and a molecular weight of 489.53 g/mol. Its IUPAC name is N-[(10S)-10-formyl-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepin-2-yl]-4-methoxybenzamide;(2S)-2-(methylamino)-4-oxopentanal.
| Compound Name | N-[(10S)-10-formyl-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepin-2-yl]-4-methoxybenzamide;(2S)-2-(methylamino)-4-oxopentanal |
|---|---|
| PubChem CID | 90979358 |
| Molecular Formula | C23H31N5O7 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | N-[(10S)-10-formyl-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepin-2-yl]-4-methoxybenzamide;(2S)-2-(methylamino)-4-oxopentanal |
| SMILES | CN[C@H](C=O)CC(C)=O.COc1ccc(C(=O)NN2CCC(=O)N3CCC[C@@H](C=O)N3C2=O)cc1 |
| InChI | InChI=1S/C17H20N4O5.C6H11NO2/c1-26-14-6-4-12(5-7-14)16(24)18-19-10-8-15(23)20-9-2-3-13(11-22)21(20)17(19)25;1-5(9)3-6(4-8)7-2/h4-7,11,13H,2-3,8-10H2,1H3,(H,18,24);4,6-7H,3H2,1-2H3/t13-;6-/m00/s1 |
| InChIKey | JBMIYFVHZJHEPB-HIBAQLOWSA-N |
| XLogP | 0.32 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|