About (E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium
(E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium (PubChem CID 59952628) has the molecular formula C18H29NOY-2
and a molecular weight of 364.34 g/mol. Its IUPAC name is (E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium.
Molecular Properties
| Compound Name | (E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium |
| PubChem CID | 59952628 |
| Molecular Formula | C18H29NOY-2 |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium |
| SMILES | CNC(C)(C)C(C)Oc1c(C)c[c-]cc1C.[CH2-]/C=C/C.[Y] |
| InChI | InChI=1S/C14H22NO.C4H7.Y/c1-10-8-7-9-11(2)13(10)16-12(3)14(4,5)15-6;1-3-4-2;/h8-9,12,15H,1-6H3;3-4H,1H2,2H3;/q2*-1;/b;4-3+; |
| InChIKey | IVIMDVWFFKRFJX-ITDJAWRYSA-N |
| XLogP | 4.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium?
The IUPAC name of (E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium (CID 59952628) is (E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium.
What is the SMILES notation for (E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium?
The canonical SMILES for (E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium is CNC(C)(C)C(C)Oc1c(C)c[c-]cc1C.[CH2-]/C=C/C.[Y].
What is the InChIKey of (E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium?
The InChIKey is IVIMDVWFFKRFJX-ITDJAWRYSA-N. The full InChI is InChI=1S/C14H22NO.C4H7.Y/c1-10-8-7-9-11(2)13(10)16-12(3)14(4,5)15-6;1-3-4-2;/h8-9,12,15H,1-6H3;3-4H,1H2,2H3;/q2*-1;/b;4-3+;.
What are the key properties of (E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium?
(E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium has a molecular weight of 364.34 g/mol, XLogP of 4.26, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium is sourced from PubChem (CID 59952628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).