C18H29NOY-2 — CID 59952628
(E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium (PubChem CID 59952628) has the molecular formula C18H29NOY-2 and a molecular weight of 364.34 g/mol. Its IUPAC name is (E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium.
| Compound Name | (E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium |
|---|---|
| PubChem CID | 59952628 |
| Molecular Formula | C18H29NOY-2 |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (E)-but-2-ene;3-(2,6-dimethylbenzene-4-id-1-yl)oxy-N,2-dimethylbutan-2-amine;yttrium |
| SMILES | CNC(C)(C)C(C)Oc1c(C)c[c-]cc1C.[CH2-]/C=C/C.[Y] |
| InChI | InChI=1S/C14H22NO.C4H7.Y/c1-10-8-7-9-11(2)13(10)16-12(3)14(4,5)15-6;1-3-4-2;/h8-9,12,15H,1-6H3;3-4H,1H2,2H3;/q2*-1;/b;4-3+; |
| InChIKey | IVIMDVWFFKRFJX-ITDJAWRYSA-N |
| XLogP | 4.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|