C16H29NO — CID 166996413
(2R)-N-ethyl-2-[(2E,4Z,6Z)-5-propan-2-ylocta-2,4,6-trien-3-yl]oxypropan-1-amine (PubChem CID 166996413) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (2R)-N-ethyl-2-[(2E,4Z,6Z)-5-propan-2-ylocta-2,4,6-trien-3-yl]oxypropan-1-amine.
| Compound Name | (2R)-N-ethyl-2-[(2E,4Z,6Z)-5-propan-2-ylocta-2,4,6-trien-3-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 166996413 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (2R)-N-ethyl-2-[(2E,4Z,6Z)-5-propan-2-ylocta-2,4,6-trien-3-yl]oxypropan-1-amine |
| SMILES | C/C=C\C(=C/C(=C\C)O[C@H](C)CNCC)C(C)C |
| InChI | InChI=1S/C16H29NO/c1-7-10-15(13(4)5)11-16(8-2)18-14(6)12-17-9-3/h7-8,10-11,13-14,17H,9,12H2,1-6H3/b10-7-,15-11+,16-8+/t14-/m1/s1 |
| InChIKey | YHXDGCYCCCKLEH-WKXGJDKRSA-N |
| XLogP | 4.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|