C24H42O2 — CID 59987645
(4R,5R,6R)-6-[(2S,3S)-3-(methoxymethoxy)-2-methylpent-4-enyl]-1-methyl-5-(2-methylpent-4-enyl)-4-propan-2-ylcyclohexene (PubChem CID 59987645) has the molecular formula C24H42O2 and a molecular weight of 362.60 g/mol. Its IUPAC name is (4R,5R,6R)-6-[(2S,3S)-3-(methoxymethoxy)-2-methylpent-4-enyl]-1-methyl-5-(2-methylpent-4-enyl)-4-propan-2-ylcyclohexene.
| Compound Name | (4R,5R,6R)-6-[(2S,3S)-3-(methoxymethoxy)-2-methylpent-4-enyl]-1-methyl-5-(2-methylpent-4-enyl)-4-propan-2-ylcyclohexene |
|---|---|
| PubChem CID | 59987645 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | (4R,5R,6R)-6-[(2S,3S)-3-(methoxymethoxy)-2-methylpent-4-enyl]-1-methyl-5-(2-methylpent-4-enyl)-4-propan-2-ylcyclohexene |
| SMILES | C=CCC(C)C[C@@H]1[C@@H](C(C)C)CC=C(C)[C@@H]1C[C@H](C)[C@H](C=C)OCOC |
| InChI | InChI=1S/C24H42O2/c1-9-11-18(5)14-23-21(17(3)4)13-12-19(6)22(23)15-20(7)24(10-2)26-16-25-8/h9-10,12,17-18,20-24H,1-2,11,13-16H2,3-8H3/t18?,20-,21+,22-,23+,24-/m0/s1 |
| InChIKey | ZUWHUGPOHJPDDR-DXPZXNCXSA-N |
| XLogP | 6.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|