C43H37N3O3S2 — CID 59993775
6-[4-[5-(4-cyanophenyl)thiophen-2-yl]phenoxy]hexyl (Z)-3-[4-[5-(dimethylamino)-1-benzothiophen-2-yl]phenyl]-2-isocyanoprop-2-enoate (PubChem CID 59993775) has the molecular formula C43H37N3O3S2 and a molecular weight of 707.92 g/mol. Its IUPAC name is 6-[4-[5-(4-cyanophenyl)thiophen-2-yl]phenoxy]hexyl (Z)-3-[4-[5-(dimethylamino)-1-benzothiophen-2-yl]phenyl]-2-isocyanoprop-2-enoate.
| Compound Name | 6-[4-[5-(4-cyanophenyl)thiophen-2-yl]phenoxy]hexyl (Z)-3-[4-[5-(dimethylamino)-1-benzothiophen-2-yl]phenyl]-2-isocyanoprop-2-enoate |
|---|---|
| PubChem CID | 59993775 |
| Molecular Formula | C43H37N3O3S2 |
| Molecular Weight | 707.92 g/mol |
| Exact Mass | 707.23 |
| IUPAC Name | 6-[4-[5-(4-cyanophenyl)thiophen-2-yl]phenoxy]hexyl (Z)-3-[4-[5-(dimethylamino)-1-benzothiophen-2-yl]phenyl]-2-isocyanoprop-2-enoate |
| SMILES | [C-]#[N+]/C(=C\c1ccc(-c2cc3cc(N(C)C)ccc3s2)cc1)C(=O)OCCCCCCOc1ccc(-c2ccc(-c3ccc(C#N)cc3)s2)cc1 |
| InChI | InChI=1S/C43H37N3O3S2/c1-45-38(26-30-8-12-34(13-9-30)42-28-35-27-36(46(2)3)18-21-41(35)51-42)43(47)49-25-7-5-4-6-24-48-37-19-16-33(17-20-37)40-23-22-39(50-40)32-14-10-31(29-44)11-15-32/h8-23,26-28H,4-7,24-25H2,2-3H3/b38-26- |
| InChIKey | CXLAOFLGXIYRHD-HBAMXUDRSA-N |
| XLogP | 11.34 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.92 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|