C34H20F6N2O7 — CID 59993853
5-[2-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]-1,3-dioxoisoindole-5-carbonyl]-2-methylisoindole-1,3-dione (PubChem CID 59993853) has the molecular formula C34H20F6N2O7 and a molecular weight of 682.53 g/mol. Its IUPAC name is 5-[2-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]-1,3-dioxoisoindole-5-carbonyl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[2-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]-1,3-dioxoisoindole-5-carbonyl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 59993853 |
| Molecular Formula | C34H20F6N2O7 |
| Molecular Weight | 682.53 g/mol |
| Exact Mass | 682.12 |
| IUPAC Name | 5-[2-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]-1,3-dioxoisoindole-5-carbonyl]-2-methylisoindole-1,3-dione |
| SMILES | Cc1cc(C(c2ccc(O)c(N3C(=O)c4ccc(C(=O)c5ccc6c(c5)C(=O)N(C)C6=O)cc4C3=O)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C34H20F6N2O7/c1-15-11-18(5-9-25(15)43)32(33(35,36)37,34(38,39)40)19-6-10-26(44)24(14-19)42-30(48)21-8-4-17(13-23(21)31(42)49)27(45)16-3-7-20-22(12-16)29(47)41(2)28(20)46/h3-14,43-44H,1-2H3 |
| InChIKey | XNNCUQDISMXRRU-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.53 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|