About CID 59999828
CID 59999828 (PubChem CID 59999828) has the molecular formula C16H19O2Si
and a molecular weight of 271.41 g/mol.
Molecular Properties
| Compound Name | CID 59999828 |
| PubChem CID | 59999828 |
| Molecular Formula | C16H19O2Si |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | — |
| SMILES | CCCCCC[Si]1Oc2cc3ccccc3cc2O1 |
| InChI | InChI=1S/C16H19O2Si/c1-2-3-4-7-10-19-17-15-11-13-8-5-6-9-14(13)12-16(15)18-19/h5-6,8-9,11-12H,2-4,7,10H2,1H3 |
| InChIKey | DOFOHVXUAFXUDQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59999828 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59999828?
The IUPAC name of CID 59999828 (CID 59999828) is not available.
What is the SMILES notation for CID 59999828?
The canonical SMILES for CID 59999828 is CCCCCC[Si]1Oc2cc3ccccc3cc2O1.
What is the InChIKey of CID 59999828?
The InChIKey is DOFOHVXUAFXUDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19O2Si/c1-2-3-4-7-10-19-17-15-11-13-8-5-6-9-14(13)12-16(15)18-19/h5-6,8-9,11-12H,2-4,7,10H2,1H3.
What are the key properties of CID 59999828?
CID 59999828 has a molecular weight of 271.41 g/mol, XLogP of 4.68, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59999828 is sourced from PubChem (CID 59999828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).