C12H12BrN3O2S — CID 6002810
1-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-prop-2-enylthiourea (PubChem CID 6002810) has the molecular formula C12H12BrN3O2S and a molecular weight of 342.22 g/mol. Its IUPAC name is 1-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-prop-2-enylthiourea.
| Compound Name | 1-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 6002810 |
| Molecular Formula | C12H12BrN3O2S |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 1-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)N/N=C\c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C12H12BrN3O2S/c1-2-3-14-12(19)16-15-6-8-4-10-11(5-9(8)13)18-7-17-10/h2,4-6H,1,3,7H2,(H2,14,16,19)/b15-6- |
| InChIKey | PNVYDFWPGXGGAA-UUASQNMZSA-N |
| XLogP | 2.16 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|