C26H23N3O4 — CID 6035875
3-[[(E)-2-benzamido-3-(9-methylcarbazol-3-yl)prop-2-enoyl]amino]propanoic acid (PubChem CID 6035875) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is 3-[[(E)-2-benzamido-3-(9-methylcarbazol-3-yl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-[[(E)-2-benzamido-3-(9-methylcarbazol-3-yl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 6035875 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 3-[[(E)-2-benzamido-3-(9-methylcarbazol-3-yl)prop-2-enoyl]amino]propanoic acid |
| SMILES | Cn1c2ccccc2c2cc(/C=C(/NC(=O)c3ccccc3)C(=O)NCCC(=O)O)ccc21 |
| InChI | InChI=1S/C26H23N3O4/c1-29-22-10-6-5-9-19(22)20-15-17(11-12-23(20)29)16-21(26(33)27-14-13-24(30)31)28-25(32)18-7-3-2-4-8-18/h2-12,15-16H,13-14H2,1H3,(H,27,33)(H,28,32)(H,30,31)/b21-16+ |
| InChIKey | JSXDTHWYXDPRBC-LTGZKZEYSA-N |
| XLogP | 3.69 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|