C15H10ClFN4O4 — CID 6049220
N'-[(Z)-(5-chloro-2-nitrophenyl)methylideneamino]-N-(4-fluorophenyl)oxamide (PubChem CID 6049220) has the molecular formula C15H10ClFN4O4 and a molecular weight of 364.72 g/mol. Its IUPAC name is N'-[(Z)-(5-chloro-2-nitrophenyl)methylideneamino]-N-(4-fluorophenyl)oxamide.
| Compound Name | N'-[(Z)-(5-chloro-2-nitrophenyl)methylideneamino]-N-(4-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 6049220 |
| Molecular Formula | C15H10ClFN4O4 |
| Molecular Weight | 364.72 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | N'-[(Z)-(5-chloro-2-nitrophenyl)methylideneamino]-N-(4-fluorophenyl)oxamide |
| SMILES | O=C(N/N=C\c1cc(Cl)ccc1[N+](=O)[O-])C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C15H10ClFN4O4/c16-10-1-6-13(21(24)25)9(7-10)8-18-20-15(23)14(22)19-12-4-2-11(17)3-5-12/h1-8H,(H,19,22)(H,20,23)/b18-8- |
| InChIKey | XDFRANOBVHCGBE-LSCVHKIXSA-N |
| XLogP | 2.48 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.72 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|