C20H24O7 — CID 606999
1-(2-hydroxy-4,6-dimethoxyphenyl)-2,2-dimethoxy-3-(4-methoxyphenyl)propan-1-one (PubChem CID 606999) has the molecular formula C20H24O7 and a molecular weight of 376.41 g/mol. Its IUPAC name is 1-(2-hydroxy-4,6-dimethoxyphenyl)-2,2-dimethoxy-3-(4-methoxyphenyl)propan-1-one.
| Compound Name | 1-(2-hydroxy-4,6-dimethoxyphenyl)-2,2-dimethoxy-3-(4-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 606999 |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 1-(2-hydroxy-4,6-dimethoxyphenyl)-2,2-dimethoxy-3-(4-methoxyphenyl)propan-1-one |
| SMILES | COc1ccc(CC(OC)(OC)C(=O)c2c(O)cc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C20H24O7/c1-23-14-8-6-13(7-9-14)12-20(26-4,27-5)19(22)18-16(21)10-15(24-2)11-17(18)25-3/h6-11,21H,12H2,1-5H3 |
| InChIKey | HRUYLQPPVRORTN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|