C25H26N2O5 — CID 6072315
(E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-methoxyphenyl)-2-(2-oxo-1-pyridinyl)prop-2-enamide (PubChem CID 6072315) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-methoxyphenyl)-2-(2-oxo-1-pyridinyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-methoxyphenyl)-2-(2-oxo-1-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 6072315 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-methoxyphenyl)-2-(2-oxo-1-pyridinyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C(\C(=O)NCCc2ccc(OC)c(OC)c2)n2ccccc2=O)cc1 |
| InChI | InChI=1S/C25H26N2O5/c1-30-20-10-7-18(8-11-20)16-21(27-15-5-4-6-24(27)28)25(29)26-14-13-19-9-12-22(31-2)23(17-19)32-3/h4-12,15-17H,13-14H2,1-3H3,(H,26,29)/b21-16+ |
| InChIKey | LPPJBSYISUMRFE-LTGZKZEYSA-N |
| XLogP | 3.23 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|