C6H10N4O2S — CID 60753914
6-(2-methylsulfanylethylamino)-2H-1,2,4-triazine-3,5-dione (PubChem CID 60753914) has the molecular formula C6H10N4O2S and a molecular weight of 202.24 g/mol. Its IUPAC name is 6-(2-methylsulfanylethylamino)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(2-methylsulfanylethylamino)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 60753914 |
| Molecular Formula | C6H10N4O2S |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 6-(2-methylsulfanylethylamino)-2H-1,2,4-triazine-3,5-dione |
| SMILES | CSCCNc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H10N4O2S/c1-13-3-2-7-4-5(11)8-6(12)10-9-4/h2-3H2,1H3,(H,7,9)(H2,8,10,11,12) |
| InChIKey | ADXFBPAKPWGTJA-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|